![Page 1: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/1.jpg)
Chemical Formulas
![Page 2: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/2.jpg)
TEKS 8.5 D and 8.5 F• Recognize that chemical formulas are used to
identify substances and determine the number of atoms of each element in chemical formulas containing subscripts.
• Recognize whether a chemical equation containing coefficients is balanced or not and how that relates to the law of conservation of mass.
• Recognize the importance of formulas and equations in representing chemical reactions– 1998 TEKS 8.9C
![Page 3: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/3.jpg)
What do you know about chemical reactions, chemical formulas, and chemical equations?
• Teacher can type answers in here.
![Page 4: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/4.jpg)
Chemical Formulas
![Page 5: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/5.jpg)
What is a chemical formula?• Chemical, or molecular, formulas are a concise
way of expressing information about the atoms that constitute a particular chemical compound.
• Wait…what?
• It is an expression which states the number and type of atoms present in a molecule of a substance.
![Page 6: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/6.jpg)
Do you know what the chemical formulas are for the following substances?
![Page 7: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/7.jpg)
Water
![Page 8: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/8.jpg)
Carbon dioxide
![Page 9: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/9.jpg)
Sodium chloride or salt
![Page 10: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/10.jpg)
Magnesium sulfate (AKA Epsom salt)
MgSO4
![Page 11: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/11.jpg)
For something more complicated….Glucose or sugar
![Page 12: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/12.jpg)
Subscripts
![Page 13: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/13.jpg)
Definition• A subscript is used to represent the number of
each atom being represented. • They are only used when more than one atom is
being represented. If only one atom is represented, there is no subscript.
• In the formula for water, what is the subscript?• There is only one atom of Oxygen, so it does not
have a subscript.
H2OH2OH = HydrogenO = Oxygen
![Page 14: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/14.jpg)
Some exceptions exist
• Usually the subscript just multiplies or shows the number of atoms of a single element. If the subscript exists outside of a set of parenthesis then it will multiply the atoms of all of the elements inside the parenthesis.
• How many of each atom are there now?• Answer: Nitrogen-1, Carbon-3, Hydrogen-9
N(CH3)
3
N = NitrogenC = CarbonH = Hydrogen
![Page 15: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/15.jpg)
Here are some molecules…
![Page 16: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/16.jpg)
• In this image Hydrogen atoms are white and Nitrogen atom is red.
• Write the chemical formula for this molecule.
Answer: NH3
This substance is ammonia
![Page 17: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/17.jpg)
• In this image the Carbon atom is black and the Oxygen atoms are red.
• Write the chemical formula for this molecule.
Answer: CO3
This substance is carbonate
![Page 18: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/18.jpg)
• In this image blue represents Nitrogen atoms, red represents Oxygen atoms, white represents Hydrogen atoms and black represents Carbon atoms.
• Write the chemical formula for this molecule.
Answer: C8H10N4O2
This substance is caffeine
![Page 19: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/19.jpg)
• In this image the Carbon atom is blue and the Oxygen atom is red.• Write the chemical formula for this
molecule.Answer: CO
This substance is carbon monoxide
![Page 20: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/20.jpg)
• A harder one:In this image Nitrogen atoms are blue, the Platinum atom is grey, Chlorine atoms are green, and Hydrogen atoms are white.
• Write the chemical formula for this molecule.
Answer: N2PtH6Cl2
![Page 21: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/21.jpg)
Coefficient
![Page 22: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/22.jpg)
7H2
O
Definition• Coefficients appear on the left side of a chemical
formula.• They are used to multiply all the atoms in a
compound• In the following formula, which is the coefficient?• Earlier we learned that the subscript 2 meant that
there were two Hydrogen atoms. The coefficient 7 means there are 7 times more.
• How many Hydrogen atoms do we have? • How many Oxygen atoms?
7H2
O
![Page 23: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/23.jpg)
Chemical Equations
![Page 24: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/24.jpg)
Chemical Equations• representation of chemical reaction in
equation: a representation, using chemical symbols in a form resembling a mathematical equation, of the process involved in a chemical reaction
• This is an example of a chemical equation. The components on the left combine together to yield (represented by the arrow) the component on the right.
2H2+O22H2O
![Page 25: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/25.jpg)
Yields
![Page 26: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/26.jpg)
Definition• The quantity of a specified product obtained in a
reaction or series of reactions, usually expressed as a percentage of the quantity that is theoretically obtainable
![Page 27: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/27.jpg)
Product
![Page 28: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/28.jpg)
Definition• What is produced. • Which side represents the products?
• They are found on the right side of a chemical equation.
2H2+O22H2O2H2+O22H2O
![Page 29: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/29.jpg)
Reactant
![Page 30: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/30.jpg)
Definition• The starting substances.• Which side represents the reactants?
• They are found on the left side of a chemical equation.
2H2+O22H2O2H2+O22H2O
![Page 31: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/31.jpg)
Law of conservation of mass
![Page 32: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/32.jpg)
• Atoms are neither created, nor destroyed, during any chemical reaction.
• This means that the same number of atoms that are present after a reaction are the same number of atoms that are present before a reaction.
• There is only a rearrangement
![Page 33: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/33.jpg)
Balancing chemical equations
![Page 34: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/34.jpg)
Subscripts are never changed when balancing an equation
![Page 35: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/35.jpg)
Step 1• Write out your “un-balanced” equation using
formulas of reactants and products.
CH4+O2CO2+H2O
![Page 36: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/36.jpg)
Step 2• Count up the atoms in the products and reactants.• How many carbons, hydrogens, and oxygens are
on each side? Are they equal?
CH4+O2CO2+H2O
C=1H=4O=2
C=1H=2O=3
They are NOT equal
![Page 37: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/37.jpg)
Step 3• Since our carbons are ok we will not mess with
those now.• However, we have half the number of hydrogens
in the products than we do in the reactants.• What do we need to add? Where do we add it?
CH4+O2CO2+H2OCH4+O2CO2+2H2
O C=1H=4O=2
C=1H=4O=4
They are still NOT equal
![Page 38: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/38.jpg)
Step 4• Now we have half the number of Oxygens.• What do we need to add? Where do we need to
add it? Is everything equal now?
CH4+O2CO2+2H2OCH4+2O2CO2+2H2
O C=1H=4O=4
C=1H=4O=4
They ARE now balanced
![Page 39: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/39.jpg)
Practice Time
![Page 40: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/40.jpg)
H2+O2H2O2H2+O22H2O
![Page 41: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/41.jpg)
Fe+Cl2FeCl32Fe+3Cl22FeCl3
![Page 42: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/42.jpg)
Cu+AgNO3Cu(NO3)2+AgCu+2AgNO3Cu(NO3)2+2Ag
![Page 43: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/43.jpg)
Zn+HClZnCl2+H2
Zn+2HClZnCl2+H2
![Page 44: Recognize that chemical formulas are used to identify substances and determine the number of atoms of each element in chemical formulas containing subscripts](https://reader031.vdocument.in/reader031/viewer/2022032309/56649d2e5503460f94a054b7/html5/thumbnails/44.jpg)
Pb(NO3)2+AlCl3PbCl2+Al(NO3)3
3Pb(NO3)2+2AlCl33PbCl2+2Al(NO3)3