plants and their parts wiki
TRANSCRIPT
![Page 1: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/1.jpg)
Plants and their parts
![Page 2: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/2.jpg)
Part=Structure
![Page 3: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/3.jpg)
Roots
![Page 4: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/4.jpg)
Roots functions
![Page 5: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/5.jpg)
1)They (hold) anchor the plant to the soil.
![Page 6: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/6.jpg)
This is the anchor that keeps the ship in its place
![Page 7: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/7.jpg)
2-They carry water andnutrients to all parts of the plants.
![Page 8: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/8.jpg)
Nutrientssubstances that help living things
grow and stayhealthy .
![Page 9: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/9.jpg)
3) Some plants store foodin them.
Example: carrots
![Page 10: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/10.jpg)
Roots types
![Page 11: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/11.jpg)
1) Taproot
![Page 12: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/12.jpg)
Beet
![Page 13: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/13.jpg)
Radish
![Page 14: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/14.jpg)
Turnip
![Page 15: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/15.jpg)
Carrot
![Page 16: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/16.jpg)
Sweet potato
![Page 17: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/17.jpg)
2)Fibrous root
![Page 18: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/18.jpg)
Cactus
![Page 19: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/19.jpg)
Wheat
![Page 20: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/20.jpg)
Taproot 0r fibrous root?
![Page 21: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/21.jpg)
So, now you can classify the plants according to their root types
![Page 22: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/22.jpg)
Stem
![Page 23: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/23.jpg)
Stem functions
![Page 24: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/24.jpg)
1- It holds the plant up (supports the plant) and enables the leaves to reach sunlight.
![Page 25: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/25.jpg)
2-It carries water, nutrients and food throughout the whole plant.
![Page 26: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/26.jpg)
Water is carried in the stem through special openings called (vessels or tubes)
![Page 27: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/27.jpg)
Stem types
![Page 28: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/28.jpg)
1) Flexible green stem
It is found in small plants Example:Tulip Stem
![Page 29: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/29.jpg)
2) Stiff woody stem(trunk)
It is found in larger plants and trees Example:Tree trunks
![Page 30: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/30.jpg)
Leaves
![Page 31: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/31.jpg)
Leaves have different sizes and shapes
![Page 32: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/32.jpg)
Leaves functions
![Page 33: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/33.jpg)
1)It is the major part in the plant where it makes its own food.
![Page 34: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/34.jpg)
2)It contains chlorophyll (chloroplast) that: a)Gives the plant its green colour.
b)Helps the plant absorb sunlight.
![Page 35: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/35.jpg)
Photosynthesis
![Page 36: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/36.jpg)
Photo = light
![Page 37: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/37.jpg)
People take in O2 and give out CO2
![Page 38: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/38.jpg)
Plants use carbon dioxide to make their food
![Page 39: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/39.jpg)
(photosynthesis) CO2+water+ sunlight food(sugar)+oxygen nutrient chlorophyll
![Page 40: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/40.jpg)
Plant takes in:1- Water and nutrient from the soil.
2-Sunlight soaks the leaves which get energy from the sunlight and trap it in the chlorophyll(chloroplast).
3-Carbon dioxide enters small holes in the underside part of the leaves.
![Page 41: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/41.jpg)
Plant gives off:
1- Oxygen which we use to breathe.
2-Sugar which is the plant food, which gives it the energy needed to grow.
![Page 42: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/42.jpg)
2. Sunlight in
Oxygen out1. Carbon dioxide in
3. Water and nutrients in
Food out
![Page 43: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/43.jpg)
Food=sugar(glucose)
![Page 44: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/44.jpg)
Remember
A green plant breathes all the time, day and night.
A green plant photosynthesizes only in the presence of sunlight.
![Page 45: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/45.jpg)
How plants are different?
• They have different shapes and sizes
![Page 46: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/46.jpg)
How are plants alike?
• 1- Have the same parts
![Page 47: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/47.jpg)
• 2-Make their own food
![Page 48: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/48.jpg)
• 3-They all have green parts
![Page 49: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/49.jpg)
• 4- Grow in the ground
![Page 50: Plants and their parts wiki](https://reader036.vdocument.in/reader036/viewer/2022062412/587d6d641a28ab32318b71e7/html5/thumbnails/50.jpg)
• 5- Can’t move like the animals