Chapter 22 ReviewChapter 22 Review“Hydrocarbon Compounds”“Hydrocarbon Compounds”

Chapter 22 ReviewChapter 22 Review How many double covalent bonds How many double covalent bonds

are in an alkane?are in an alkane? Alkanes do not have geometric Alkanes do not have geometric

isomers because the carbon atoms isomers because the carbon atoms in their carbon-carbon bonds are __.in their carbon-carbon bonds are __.

Draw the condensed structural Draw the condensed structural formula for 2,2,3-trimethylbutane.formula for 2,2,3-trimethylbutane.

Know characteristics of structural Know characteristics of structural isomers.isomers.

Chapter 22 ReviewChapter 22 Review The general name for hydrocarbons The general name for hydrocarbons

with at least one triple covalent with at least one triple covalent bond is ____.bond is ____.

What is the first stage in the What is the first stage in the formation of coal?formation of coal?

A structural isomer of hexane is: A structural isomer of hexane is: a) 2,2-dimethylbutane, or a) 2,2-dimethylbutane, or b) benzene?b) benzene?

Chapter 22 ReviewChapter 22 Review Which of the following is a structural Which of the following is a structural

isomer of butane: a) 2-methylbutane, or isomer of butane: a) 2-methylbutane, or b) 2-methylpropane?b) 2-methylpropane?

What is the name of the smallest What is the name of the smallest alkyne?alkyne?

The controlled process by which The controlled process by which hydrocarbons are broken down or hydrocarbons are broken down or rearranged into smaller, more useful rearranged into smaller, more useful molecules is called ____.molecules is called ____.

Chapter 22 ReviewChapter 22 Review How many valence electrons does a How many valence electrons does a

carbon atom have?carbon atom have? What is the increment of change in What is the increment of change in

a series of straight-chain alkanes?a series of straight-chain alkanes? Which of these is an alkene: Which of these is an alkene:

a) propanone, or b) nonene?a) propanone, or b) nonene? What is the name of the alkane What is the name of the alkane

having five carbons?having five carbons?

Chapter 22 ReviewChapter 22 Review Alkanes are hydrocarbons that Alkanes are hydrocarbons that

contain what type of bonds?contain what type of bonds? In which of the following compounds In which of the following compounds

does rotation occur around all does rotation occur around all covalent bonds between carbons: covalent bonds between carbons: a) octane, or b) octene?a) octane, or b) octene?

What is the first step in the refining What is the first step in the refining of petroleum?of petroleum?

Chapter 22 ReviewChapter 22 Review What is the condensed structural What is the condensed structural

formula for 2,2-dimethylbutane?formula for 2,2-dimethylbutane? The longest continuous carbon The longest continuous carbon

chain of a branched-chain chain of a branched-chain hydrocarbon is called a(n) ____.hydrocarbon is called a(n) ____.

An organic compound that contains An organic compound that contains only carbon and hydrogen, and at only carbon and hydrogen, and at least one carbon-carbon triple bond least one carbon-carbon triple bond is classified as an ____.is classified as an ____.

Chapter 22 ReviewChapter 22 Review How many different atoms or groups How many different atoms or groups

are attached to an asymmetric are attached to an asymmetric carbon?carbon?

How many carbons are in a How many carbons are in a molecule of hexane?molecule of hexane?

Hydrocarbons containing a Hydrocarbons containing a saturated carbon ring are called saturated carbon ring are called ____.____.

Chapter 22 ReviewChapter 22 Review What compound is the simplest What compound is the simplest

aromatic compound?aromatic compound? What is the general formula for a What is the general formula for a

straight-chain alkane?straight-chain alkane? How many covalent bonds can each How many covalent bonds can each

carbon atom form?carbon atom form? Which type of coal has the highest Which type of coal has the highest

carbon content?carbon content?

Chapter 22 ReviewChapter 22 Review In the In the cis-cis- configuration, the methyl configuration, the methyl

groups are placed ____.groups are placed ____. Which of the following compounds is an Which of the following compounds is an

unsaturated hydrocarbon: a) nonane, unsaturated hydrocarbon: a) nonane, or b) propyne?or b) propyne?

What is the simplest straight-chain What is the simplest straight-chain alkane?alkane?

In which of the following liquids is In which of the following liquids is hexane most likely to dissolve: hexane most likely to dissolve: a) vinegar, or b) octane?a) vinegar, or b) octane?

Chapter 22 ReviewChapter 22 Review Which hydrocarbon rings are most Which hydrocarbon rings are most

common in nature: common in nature: a) rings with 4 or 5 carbon atoms, or a) rings with 4 or 5 carbon atoms, or b) rings with 5 or 6 carbon atoms?b) rings with 5 or 6 carbon atoms?

Which of the following is NOT a fraction Which of the following is NOT a fraction obtained from crude oil: a) ammonia, or obtained from crude oil: a) ammonia, or b) kerosene?b) kerosene?

What is the physical state of the What is the physical state of the smallest alkanes at room conditions?smallest alkanes at room conditions?

Chapter 22 ReviewChapter 22 Review Which of the following is NOT an Which of the following is NOT an

important fossil fuel: a) hydrogen, important fossil fuel: a) hydrogen, or b) coal?or b) coal?

The names of the straight-chain The names of the straight-chain alkanes all end with the suffix alkanes all end with the suffix ____.____.

Why are the molecules of Why are the molecules of hydrocarbons nonpolar?hydrocarbons nonpolar?

Chapter 22 ReviewChapter 22 Review In a cyclic hydrocarbon with only In a cyclic hydrocarbon with only

carbon-carbon single bonds and carbon-carbon single bonds and nn number of carbon atoms, how number of carbon atoms, how many hydrogen atoms are there in many hydrogen atoms are there in terms of terms of nn??

The name for an alkyl group that The name for an alkyl group that contains two carbon atoms is contains two carbon atoms is ____.____.

Chapter 22 ReviewChapter 22 Review Which of the following is NOT a Which of the following is NOT a

product obtained from the distillation product obtained from the distillation of coal tar: a) coke, or b) benzene?of coal tar: a) coke, or b) benzene?

What is the simplest alkane?What is the simplest alkane? What is the condensed structural What is the condensed structural

formula for propane?formula for propane? How are hydrogen atoms arranged How are hydrogen atoms arranged

in ethene?in ethene?

Chapter 22 ReviewChapter 22 Review What is the main hydrocarbon What is the main hydrocarbon

component of natural gas?component of natural gas? A saturated straight-chain A saturated straight-chain

hydrocarbon with two carbons is __.hydrocarbon with two carbons is __. What is the name of the compound What is the name of the compound

CHCH33CH(CHCH(CH33)C(CH)C(CH33))33?? How many more hydrogen atoms How many more hydrogen atoms

does a cyclohexane molecule have does a cyclohexane molecule have than a benzene molecule?than a benzene molecule?

Chapter 22 ReviewChapter 22 Review What percent of the composition of What percent of the composition of

natural gas is methane?natural gas is methane? How many forms of coal are there?How many forms of coal are there? How many arrangements are How many arrangements are

possible for two methyl groups with possible for two methyl groups with respect to a rigid double bond?respect to a rigid double bond?